C25H27FN5O5PS — CID 145046111
S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 4-methylbenzenecarbothioate (PubChem CID 145046111) has the molecular formula C25H27FN5O5PS and a molecular weight of 559.56 g/mol. Its IUPAC name is S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 4-methylbenzenecarbothioate.
| Compound Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 4-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 145046111 |
| Molecular Formula | C25H27FN5O5PS |
| Molecular Weight | 559.56 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | S-[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[(3-fluorophenyl)methoxy]phosphanyl]oxyethyl] 4-methylbenzenecarbothioate |
| SMILES | Cc1ccc(C(=O)SCCOP(COCCn2cnc3c(=O)[nH]c(N)nc32)OCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C25H27FN5O5PS/c1-17-5-7-19(8-6-17)24(33)38-12-11-35-37(36-14-18-3-2-4-20(26)13-18)16-34-10-9-31-15-28-21-22(31)29-25(27)30-23(21)32/h2-8,13,15H,9-12,14,16H2,1H3,(H3,27,29,30,32) |
| InChIKey | XEIBKXBBPCQZMB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|