C20H20FN6O7P — CID 145045839
2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(5-nitrofuran-2-yl)methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 145045839) has the molecular formula C20H20FN6O7P and a molecular weight of 506.39 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(5-nitrofuran-2-yl)methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(5-nitrofuran-2-yl)methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 145045839 |
| Molecular Formula | C20H20FN6O7P |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluorophenyl)methoxy-[(5-nitrofuran-2-yl)methoxy]phosphanyl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2CCOCP(OCc2cccc(F)c2)OCc2ccc([N+](=O)[O-])o2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H20FN6O7P/c21-14-3-1-2-13(8-14)9-32-35(33-10-15-4-5-16(34-15)27(29)30)12-31-7-6-26-11-23-17-18(26)24-20(22)25-19(17)28/h1-5,8,11H,6-7,9-10,12H2,(H3,22,24,25,28) |
| InChIKey | ABNISDMOLUVUKM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|