C18H25ClN7O7P — CID 136953828
2-amino-9-[2-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953828) has the molecular formula C18H25ClN7O7P and a molecular weight of 517.87 g/mol. Its IUPAC name is 2-amino-9-[2-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953828 |
| Molecular Formula | C18H25ClN7O7P |
| Molecular Weight | 517.87 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 2-amino-9-[2-[[[4-chlorobutyl(methyl)amino]-[(5-nitrofuran-2-yl)methoxy]phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | CN(CCCCCl)P(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H25ClN7O7P/c1-24(7-3-2-6-19)34(30,32-10-13-4-5-14(33-13)26(28)29)12-31-9-8-25-11-21-15-16(25)22-18(20)23-17(15)27/h4-5,11H,2-3,6-10,12H2,1H3,(H3,20,22,23,27) |
| InChIKey | FBFIQXPSDHZGKS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 184.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|