C15H19N6O4P — CID 136953538
2-amino-9-[2-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one (PubChem CID 136953538) has the molecular formula C15H19N6O4P and a molecular weight of 378.33 g/mol. Its IUPAC name is 2-amino-9-[2-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[2-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 136953538 |
| Molecular Formula | C15H19N6O4P |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-amino-9-[2-[[methyl(pyridin-3-ylmethoxy)phosphoryl]methoxy]ethyl]-1H-purin-6-one |
| SMILES | CP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1cccnc1 |
| InChI | InChI=1S/C15H19N6O4P/c1-26(23,25-8-11-3-2-4-17-7-11)10-24-6-5-21-9-18-12-13(21)19-15(16)20-14(12)22/h2-4,7,9H,5-6,8,10H2,1H3,(H3,16,19,20,22) |
| InChIKey | JNYOQDMOELZXDR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|