C9H15N5O8P2 — CID 136638197
2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[hydroxy(methoxy)phosphoryl]oxyphosphinic acid (PubChem CID 136638197) has the molecular formula C9H15N5O8P2 and a molecular weight of 383.19 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[hydroxy(methoxy)phosphoryl]oxyphosphinic acid.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[hydroxy(methoxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 136638197 |
| Molecular Formula | C9H15N5O8P2 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-[hydroxy(methoxy)phosphoryl]oxyphosphinic acid |
| SMILES | COP(=O)(O)OP(=O)(O)COCCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C9H15N5O8P2/c1-20-24(18,19)22-23(16,17)5-21-3-2-14-4-11-6-7(14)12-9(10)13-8(6)15/h4H,2-3,5H2,1H3,(H,16,17)(H,18,19)(H3,10,12,13,15) |
| InChIKey | QKFZKMVJQFHTIS-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 191.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|