C11H18N5O11P3 — CID 136635839
[(E)-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]but-2-enoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid (PubChem CID 136635839) has the molecular formula C11H18N5O11P3 and a molecular weight of 489.21 g/mol. Its IUPAC name is [(E)-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]but-2-enoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid.
| Compound Name | [(E)-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]but-2-enoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 136635839 |
| Molecular Formula | C11H18N5O11P3 |
| Molecular Weight | 489.21 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | [(E)-2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]but-2-enoxy]methyl-[hydroxy(phosphonooxy)phosphoryl]oxyphosphinic acid |
| SMILES | C/C=C(/COCP(=O)(O)OP(=O)(O)OP(=O)(O)O)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H18N5O11P3/c1-2-7(3-16-5-13-8-9(16)14-11(12)15-10(8)17)4-25-6-28(18,19)26-30(23,24)27-29(20,21)22/h2,5H,3-4,6H2,1H3,(H,18,19)(H,23,24)(H2,20,21,22)(H3,12,14,15,17)/b7-2+ |
| InChIKey | HLRKSOWRACXQKA-FARCUNLSSA-N |
| XLogP | 0.03 |
| TPSA | 249.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|