C11H19N5O8P2 — CID 143349879
[2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-methoxyphosphoryl] dimethyl phosphate (PubChem CID 143349879) has the molecular formula C11H19N5O8P2 and a molecular weight of 411.25 g/mol. Its IUPAC name is [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-methoxyphosphoryl] dimethyl phosphate.
| Compound Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-methoxyphosphoryl] dimethyl phosphate |
|---|---|
| PubChem CID | 143349879 |
| Molecular Formula | C11H19N5O8P2 |
| Molecular Weight | 411.25 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | [2-(2-amino-6-oxo-1H-purin-9-yl)ethoxymethyl-methoxyphosphoryl] dimethyl phosphate |
| SMILES | COP(=O)(COCCn1cnc2c(=O)[nH]c(N)nc21)OP(=O)(OC)OC |
| InChI | InChI=1S/C11H19N5O8P2/c1-20-25(18,24-26(19,21-2)22-3)7-23-5-4-16-6-13-8-9(16)14-11(12)15-10(8)17/h6H,4-5,7H2,1-3H3,(H3,12,14,15,17) |
| InChIKey | JTWBPUWSSMTEGR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 169.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|