C23H34N5O5PS — CID 145046107
2-amino-9-[2-[[2-methylsulfanylethoxy(phenylmethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one;2,2-dimethylpropanal (PubChem CID 145046107) has the molecular formula C23H34N5O5PS and a molecular weight of 523.60 g/mol. Its IUPAC name is 2-amino-9-[2-[[2-methylsulfanylethoxy(phenylmethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one;2,2-dimethylpropanal.
| Compound Name | 2-amino-9-[2-[[2-methylsulfanylethoxy(phenylmethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one;2,2-dimethylpropanal |
|---|---|
| PubChem CID | 145046107 |
| Molecular Formula | C23H34N5O5PS |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 2-amino-9-[2-[[2-methylsulfanylethoxy(phenylmethoxy)phosphanyl]methoxy]ethyl]-1H-purin-6-one;2,2-dimethylpropanal |
| SMILES | CC(C)(C)C=O.CSCCOP(COCCn1cnc2c(=O)[nH]c(N)nc21)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N5O4PS.C5H10O/c1-29-10-9-26-28(27-11-14-5-3-2-4-6-14)13-25-8-7-23-12-20-15-16(23)21-18(19)22-17(15)24;1-5(2,3)4-6/h2-6,12H,7-11,13H2,1H3,(H3,19,21,22,24);4H,1-3H3 |
| InChIKey | NCWXDFPALTZTRD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 134.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|