C22H32FN6O6P — CID 145045997
2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-(propan-2-ylamino)phosphanyl]methoxy]ethyl]-1H-purin-6-one;ethyl formate (PubChem CID 145045997) has the molecular formula C22H32FN6O6P and a molecular weight of 526.51 g/mol. Its IUPAC name is 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-(propan-2-ylamino)phosphanyl]methoxy]ethyl]-1H-purin-6-one;ethyl formate.
| Compound Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-(propan-2-ylamino)phosphanyl]methoxy]ethyl]-1H-purin-6-one;ethyl formate |
|---|---|
| PubChem CID | 145045997 |
| Molecular Formula | C22H32FN6O6P |
| Molecular Weight | 526.51 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-amino-9-[2-[[(3-fluoro-4-methoxyphenyl)methoxy-(propan-2-ylamino)phosphanyl]methoxy]ethyl]-1H-purin-6-one;ethyl formate |
| SMILES | CCOC=O.COc1ccc(COP(COCCn2cnc3c(=O)[nH]c(N)nc32)NC(C)C)cc1F |
| InChI | InChI=1S/C19H26FN6O4P.C3H6O2/c1-12(2)25-31(30-9-13-4-5-15(28-3)14(20)8-13)11-29-7-6-26-10-22-16-17(26)23-19(21)24-18(16)27;1-2-5-3-4/h4-5,8,10,12,25H,6-7,9,11H2,1-3H3,(H3,21,23,24,27);3H,2H2,1H3 |
| InChIKey | CWYUIFQCEIZZJD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 155.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|