C21H29N6O5P — CID 177169827
ethyl (2R)-2-[[2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate (PubChem CID 177169827) has the molecular formula C21H29N6O5P and a molecular weight of 476.47 g/mol. Its IUPAC name is ethyl (2R)-2-[[2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate |
|---|---|
| PubChem CID | 177169827 |
| Molecular Formula | C21H29N6O5P |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl (2R)-2-[[2-(2-amino-6-methoxypurin-9-yl)ethoxymethyl-phenylmethoxyphosphanyl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N[P@](COCCn1cnc2c(OC)nc(N)nc21)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N6O5P/c1-4-31-20(28)15(2)26-33(32-12-16-8-6-5-7-9-16)14-30-11-10-27-13-23-17-18(27)24-21(22)25-19(17)29-3/h5-9,13,15,26H,4,10-12,14H2,1-3H3,(H2,22,24,25)/t15-,33+/m1/s1 |
| InChIKey | GISFDTGYZJOSKF-CAROCFPZSA-N |
| XLogP | 2.46 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|