C21H29N6O6P — CID 171459500
ethyl 2-[[2-[2-amino-6-(hydroxymethyl)purin-9-yl]ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate (PubChem CID 171459500) has the molecular formula C21H29N6O6P and a molecular weight of 492.47 g/mol. Its IUPAC name is ethyl 2-[[2-[2-amino-6-(hydroxymethyl)purin-9-yl]ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[2-[2-amino-6-(hydroxymethyl)purin-9-yl]ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 171459500 |
| Molecular Formula | C21H29N6O6P |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | ethyl 2-[[2-[2-amino-6-(hydroxymethyl)purin-9-yl]ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)C(C)N[P@](=O)(COCCn1cnc2c(CO)nc(N)nc21)OCc1ccccc1 |
| InChI | InChI=1S/C21H29N6O6P/c1-3-32-20(29)15(2)26-34(30,33-12-16-7-5-4-6-8-16)14-31-10-9-27-13-23-18-17(11-28)24-21(22)25-19(18)27/h4-8,13,15,28H,3,9-12,14H2,1-2H3,(H,26,30)(H2,22,24,25)/t15?,34-/m0/s1 |
| InChIKey | LLPUYIXPIKFNDU-MZINZRKNSA-N |
| XLogP | 1.83 |
| TPSA | 163.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|