C21H31N6O6P — CID 163768579
ethyl (2S)-2-[[2-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate (PubChem CID 163768579) has the molecular formula C21H31N6O6P and a molecular weight of 494.49 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 163768579 |
| Molecular Formula | C21H31N6O6P |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | ethyl (2S)-2-[[2-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)ethoxymethyl-phenylmethoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(COCCN1C=NC2C(OC)=NC(N)=NC21)OCc1ccccc1 |
| InChI | InChI=1S/C21H31N6O6P/c1-4-32-20(28)15(2)26-34(29,33-12-16-8-6-5-7-9-16)14-31-11-10-27-13-23-17-18(27)24-21(22)25-19(17)30-3/h5-9,13,15,17-18H,4,10-12,14H2,1-3H3,(H2,22,24)(H,26,29)/t15-,17?,18?,34?/m0/s1 |
| InChIKey | MEMGYJNHFXNCGR-QDJKJHTHSA-N |
| XLogP | 1.32 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|