C35H42N5O6P — CID 166582318
benzyl (2S)-2-[[[(3S)-3-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 166582318) has the molecular formula C35H42N5O6P and a molecular weight of 659.72 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(3S)-3-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(3S)-3-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166582318 |
| Molecular Formula | C35H42N5O6P |
| Molecular Weight | 659.72 g/mol |
| Exact Mass | 659.29 |
| IUPAC Name | benzyl (2S)-2-[[[(3S)-3-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCC[C@@H](CCO[P@@](=O)(N[C@@H](C)C(=O)OCc1ccccc1)Oc1ccccc1)n1c(COCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C35H42N5O6P/c1-4-14-27(40-31(24-43-5-2)38-32-33(40)29-19-12-13-20-30(29)37-34(32)36)21-22-45-47(42,46-28-17-10-7-11-18-28)39-25(3)35(41)44-23-26-15-8-6-9-16-26/h6-13,15-20,25,27H,4-5,14,21-24H2,1-3H3,(H2,36,37)(H,39,42)/t25-,27-,47-/m0/s1 |
| InChIKey | PDLKOBFXCORPMV-CYKKSHSMSA-N |
| XLogP | 7.36 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.72 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|