C34H40N5O6P — CID 166582666
phenyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 166582666) has the molecular formula C34H40N5O6P and a molecular weight of 645.70 g/mol. Its IUPAC name is phenyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | phenyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166582666 |
| Molecular Formula | C34H40N5O6P |
| Molecular Weight | 645.70 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | phenyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]hexoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCCC[C@H](CO[P@@](=O)(N[C@@H](C)C(=O)Oc1ccccc1)Oc1ccccc1)n1c(COCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C34H40N5O6P/c1-4-6-15-25(39-30(23-42-5-2)37-31-32(39)28-20-13-14-21-29(28)36-33(31)35)22-43-46(41,45-27-18-11-8-12-19-27)38-24(3)34(40)44-26-16-9-7-10-17-26/h7-14,16-21,24-25H,4-6,15,22-23H2,1-3H3,(H2,35,36)(H,38,41)/t24-,25+,46-/m0/s1 |
| InChIKey | WZBKFRLYSQEQSM-DEPXFSRHSA-N |
| XLogP | 7.22 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.70 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|