C34H42N5O6P — CID 166582377
butyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butoxy]-naphthalen-2-yloxyphosphoryl]amino]propanoate (PubChem CID 166582377) has the molecular formula C34H42N5O6P and a molecular weight of 647.71 g/mol. Its IUPAC name is butyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butoxy]-naphthalen-2-yloxyphosphoryl]amino]propanoate.
| Compound Name | butyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butoxy]-naphthalen-2-yloxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 166582377 |
| Molecular Formula | C34H42N5O6P |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | butyl (2S)-2-[[[(2R)-2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butoxy]-naphthalen-2-yloxyphosphoryl]amino]propanoate |
| SMILES | CCCCOC(=O)[C@H](C)N[P@](=O)(OC[C@@H](CC)n1c(COCC)nc2c(N)nc3ccccc3c21)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H42N5O6P/c1-5-8-19-43-34(40)23(4)38-46(41,45-27-18-17-24-13-9-10-14-25(24)20-27)44-21-26(6-2)39-30(22-42-7-3)37-31-32(39)28-15-11-12-16-29(28)36-33(31)35/h9-18,20,23,26H,5-8,19,21-22H2,1-4H3,(H2,35,36)(H,38,41)/t23-,26+,46-/m0/s1 |
| InChIKey | RAZJUJVCIVRXJY-LSADIPJLSA-N |
| XLogP | 7.33 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|