C29H39N6O5P — CID 167308129
(2S)-2-[[[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylhexoxy]-phenoxyphosphoryl]amino]propanamide (PubChem CID 167308129) has the molecular formula C29H39N6O5P and a molecular weight of 582.64 g/mol. Its IUPAC name is (2S)-2-[[[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylhexoxy]-phenoxyphosphoryl]amino]propanamide.
| Compound Name | (2S)-2-[[[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylhexoxy]-phenoxyphosphoryl]amino]propanamide |
|---|---|
| PubChem CID | 167308129 |
| Molecular Formula | C29H39N6O5P |
| Molecular Weight | 582.64 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | (2S)-2-[[[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylhexoxy]-phenoxyphosphoryl]amino]propanamide |
| SMILES | CCCCC(C)(CO[P@](=O)(N[C@@H](C)C(N)=O)Oc1ccccc1)n1c(COCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C29H39N6O5P/c1-5-7-17-29(4,19-39-41(37,34-20(3)28(31)36)40-21-13-9-8-10-14-21)35-24(18-38-6-2)33-25-26(35)22-15-11-12-16-23(22)32-27(25)30/h8-16,20H,5-7,17-19H2,1-4H3,(H2,30,32)(H2,31,36)(H,34,37)/t20-,29?,41+/m0/s1 |
| InChIKey | PPDMSRZAWNSFMJ-VWFXHYBZSA-N |
| XLogP | 5.28 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|