C25H37N6O9PS — CID 118550516
S-[2-[[(2R,4R,5R)-5-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 118550516) has the molecular formula C25H37N6O9PS and a molecular weight of 628.65 g/mol. Its IUPAC name is S-[2-[[(2R,4R,5R)-5-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,4R,5R)-5-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 118550516 |
| Molecular Formula | C25H37N6O9PS |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | S-[2-[[(2R,4R,5R)-5-(2-amino-6-methoxy-4,5-dihydropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | COC1=NC(N)=NC2C1N=CN2[C@@H]1O[C@H](COP(=O)(NCc2ccccc2)OCCSC(=O)C(C)(C)CO)C(O)[C@H]1O |
| InChI | InChI=1S/C25H37N6O9PS/c1-25(2,13-32)23(35)42-10-9-38-41(36,28-11-15-7-5-4-6-8-15)39-12-16-18(33)19(34)22(40-16)31-14-27-17-20(31)29-24(26)30-21(17)37-3/h4-8,14,16-20,22,32-34H,9-13H2,1-3H3,(H2,26,29)(H,28,36)/t16-,17?,18?,19-,20?,22-,41?/m1/s1 |
| InChIKey | PMNQHLQNFOICTG-XGMFPLQMSA-N |
| XLogP | 0.05 |
| TPSA | 210.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|