C26H35FN5O8PS — CID 88884541
S-[2-[[(2R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 88884541) has the molecular formula C26H35FN5O8PS and a molecular weight of 627.63 g/mol. Its IUPAC name is S-[2-[[(2R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 88884541 |
| Molecular Formula | C26H35FN5O8PS |
| Molecular Weight | 627.63 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | S-[2-[[(2R,5R)-5-(4-amino-5-fluoropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1O[C@@H](n2cc(F)c3c(N)ncnc32)C(C)(O)C1O |
| InChI | InChI=1S/C26H35FN5O8PS/c1-25(2,14-33)24(35)42-10-9-38-41(37,31-11-16-7-5-4-6-8-16)39-13-18-20(34)26(3,36)23(40-18)32-12-17(27)19-21(28)29-15-30-22(19)32/h4-8,12,15,18,20,23,33-34,36H,9-11,13-14H2,1-3H3,(H,31,37)(H2,28,29,30)/t18-,20?,23-,26?,41?/m1/s1 |
| InChIKey | NFEZVFVFAHMRCQ-NZBARKLCSA-N |
| XLogP | 2.37 |
| TPSA | 191.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.63 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|