C25H36N3O10PS — CID 173476051
S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-5-(4-methoxy-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 173476051) has the molecular formula C25H36N3O10PS and a molecular weight of 601.62 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-5-(4-methoxy-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-5-(4-methoxy-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 173476051 |
| Molecular Formula | C25H36N3O10PS |
| Molecular Weight | 601.62 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-5-(4-methoxy-2-oxopyrimidin-1-yl)-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | COc1ccn(C2O[C@H](COP(=O)(NCc3ccccc3)OCCSC(=O)C(C)(C)CO)C(O)[C@]2(C)O)c(=O)n1 |
| InChI | InChI=1S/C25H36N3O10PS/c1-24(2,16-29)22(31)40-13-12-36-39(34,26-14-17-8-6-5-7-9-17)37-15-18-20(30)25(3,33)21(38-18)28-11-10-19(35-4)27-23(28)32/h5-11,18,20-21,29-30,33H,12-16H2,1-4H3,(H,26,34)/t18-,20?,21?,25+,39?/m1/s1 |
| InChIKey | JPYQUQULFOFSFW-ZLBCRGQGSA-N |
| XLogP | 1.47 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.62 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|