C26H38N3O9PS — CID 173466587
S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylbutanethioate (PubChem CID 173466587) has the molecular formula C26H38N3O9PS and a molecular weight of 599.64 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylbutanethioate.
| Compound Name | S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 173466587 |
| Molecular Formula | C26H38N3O9PS |
| Molecular Weight | 599.64 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | S-[2-[(benzylamino)-[[(2R,4S)-3,4-dihydroxy-4-methyl-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
| SMILES | CCC(C)(C)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1OC(n2cc(C)c(=O)[nH]c2=O)[C@@](C)(O)C1O |
| InChI | InChI=1S/C26H38N3O9PS/c1-6-25(3,4)23(32)40-13-12-36-39(35,27-14-18-10-8-7-9-11-18)37-16-19-20(30)26(5,34)22(38-19)29-15-17(2)21(31)28-24(29)33/h7-11,15,19-20,22,30,34H,6,12-14,16H2,1-5H3,(H,27,35)(H,28,31,33)/t19-,20?,22?,26+,39?/m1/s1 |
| InChIKey | ITTZSQBEIKVSSF-XEGKFMQRSA-N |
| XLogP | 2.48 |
| TPSA | 169.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.64 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|