C24H34N3O10PS — CID 89148838
S-[2-[(benzylamino)-[[(2R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 89148838) has the molecular formula C24H34N3O10PS and a molecular weight of 587.59 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[[(2R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(benzylamino)-[[(2R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 89148838 |
| Molecular Formula | C24H34N3O10PS |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | S-[2-[(benzylamino)-[[(2R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxy-3-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1OC(n2ccc(=O)[nH]c2=O)C(O)C1(C)O |
| InChI | InChI=1S/C24H34N3O10PS/c1-23(2,15-28)21(31)39-12-11-35-38(34,25-13-16-7-5-4-6-8-16)36-14-17-24(3,33)19(30)20(37-17)27-10-9-18(29)26-22(27)32/h4-10,17,19-20,28,30,33H,11-15H2,1-3H3,(H,25,34)(H,26,29,32)/t17-,19?,20?,24?,38?/m1/s1 |
| InChIKey | NLHYXUPMNUNDJA-MSNMTXBHSA-N |
| XLogP | 0.76 |
| TPSA | 189.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|