C27H39N4O10PS — CID 163660391
S-[2-[(benzylamino)-[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate (PubChem CID 163660391) has the molecular formula C27H39N4O10PS and a molecular weight of 642.67 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate.
| Compound Name | S-[2-[(benzylamino)-[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 163660391 |
| Molecular Formula | C27H39N4O10PS |
| Molecular Weight | 642.67 g/mol |
| Exact Mass | 642.21 |
| IUPAC Name | S-[2-[(benzylamino)-[[(2R,3S,4S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
| SMILES | COC(=O)NCCC(C)(C)C(=O)SCCO[P@](=O)(NCc1ccccc1)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H39N4O10PS/c1-18-22(33)20(41-23(18)31-13-10-21(32)30-25(31)35)17-40-42(37,29-16-19-8-6-5-7-9-19)39-14-15-43-24(34)27(2,3)11-12-28-26(36)38-4/h5-10,13,18,20,22-23,33H,11-12,14-17H2,1-4H3,(H,28,36)(H,29,37)(H,30,32,35)/t18-,20+,22-,23+,42+/m0/s1 |
| InChIKey | ITWOOIZKBYVFBT-PHKGAGBJSA-N |
| XLogP | 2.39 |
| TPSA | 187.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.67 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|