C24H35N4O7PS — CID 88938342
S-[2-[[(2S,3S,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate (PubChem CID 88938342) has the molecular formula C24H35N4O7PS and a molecular weight of 554.61 g/mol. Its IUPAC name is S-[2-[[(2S,3S,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate.
| Compound Name | S-[2-[[(2S,3S,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 88938342 |
| Molecular Formula | C24H35N4O7PS |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | S-[2-[[(2S,3S,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
| SMILES | CCC(C)(C)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@@H]1O[C@H](n2ccc(N)nc2=O)C[C@@H]1O |
| InChI | InChI=1S/C24H35N4O7PS/c1-4-24(2,3)22(30)37-13-12-33-36(32,26-15-17-8-6-5-7-9-17)34-16-19-18(29)14-21(35-19)28-11-10-20(25)27-23(28)31/h5-11,18-19,21,29H,4,12-16H2,1-3H3,(H,26,32)(H2,25,27,31)/t18-,19-,21-,36?/m0/s1 |
| InChIKey | DFTAXRXPIHTFPF-GQMGPUPRSA-N |
| XLogP | 3.10 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|