C28H35FN5O7PS — CID 58519586
S-[2-[[(2R,3S,5R)-5-(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate (PubChem CID 58519586) has the molecular formula C28H35FN5O7PS and a molecular weight of 635.66 g/mol. Its IUPAC name is S-[2-[[(2R,3S,5R)-5-(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate.
| Compound Name | S-[2-[[(2R,3S,5R)-5-(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 58519586 |
| Molecular Formula | C28H35FN5O7PS |
| Molecular Weight | 635.66 g/mol |
| Exact Mass | 635.20 |
| IUPAC Name | S-[2-[[(2R,3S,5R)-5-(5-amino-7-oxo-6H-imidazo[4,5-b]pyridin-3-yl)-4-ethynyl-4-fluoro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 2,2-dimethylbutanethioate |
| SMILES | C#CC1(F)[C@@H](O)[C@@H](COP(=O)(NCc2ccccc2)OCCSC(=O)C(C)(C)CC)O[C@H]1n1cnc2c1N=C(N)CC2=O |
| InChI | InChI=1S/C28H35FN5O7PS/c1-5-27(3,4)26(37)43-13-12-39-42(38,32-15-18-10-8-7-9-11-18)40-16-20-23(36)28(29,6-2)25(41-20)34-17-31-22-19(35)14-21(30)33-24(22)34/h2,7-11,17,20,23,25,36H,5,12-16H2,1,3-4H3,(H2,30,33)(H,32,38)/t20-,23+,25-,28?,42?/m1/s1 |
| InChIKey | LLGSTQPQDVUXEM-SXGCBNIBSA-N |
| XLogP | 3.69 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.66 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|