C25H34ClN6O8PS — CID 136980548
S-[2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 136980548) has the molecular formula C25H34ClN6O8PS and a molecular weight of 645.08 g/mol. Its IUPAC name is S-[2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 136980548 |
| Molecular Formula | C25H34ClN6O8PS |
| Molecular Weight | 645.08 g/mol |
| Exact Mass | 644.16 |
| IUPAC Name | S-[2-[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-chloro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCO[P@@](=O)(NCc1ccccc1)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(Cl)[C@@H]1O |
| InChI | InChI=1S/C25H34ClN6O8PS/c1-24(2,13-33)22(36)42-10-9-38-41(37,29-11-15-7-5-4-6-8-15)39-12-16-18(34)25(3,26)21(40-16)32-14-28-17-19(32)30-23(27)31-20(17)35/h4-8,14,16,18,21,33-34H,9-13H2,1-3H3,(H,29,37)(H3,27,30,31,35)/t16-,18-,21-,25-,41+/m1/s1 |
| InChIKey | SMZBRGWEHWOZDN-BSKUKORFSA-N |
| XLogP | 2.17 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.08 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|