C24H33N6O9P — CID 136504910
[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 136504910) has the molecular formula C24H33N6O9P and a molecular weight of 580.54 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 136504910 |
| Molecular Formula | C24H33N6O9P |
| Molecular Weight | 580.54 g/mol |
| Exact Mass | 580.20 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(NCc1ccccc1)OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C24H33N6O9P/c1-23(2,3)21(33)36-13-38-40(35,27-10-14-8-6-5-7-9-14)37-11-15-17(31)24(4,34)20(39-15)30-12-26-16-18(30)28-22(25)29-19(16)32/h5-9,12,15,17,20,31,34H,10-11,13H2,1-4H3,(H,27,35)(H3,25,28,29,32)/t15-,17-,20-,24-,40?/m1/s1 |
| InChIKey | AIKDDXHSOHSKPE-SISFEJJSSA-N |
| XLogP | 1.19 |
| TPSA | 213.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.54 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|