C18H23N6O7P — CID 136592208
[(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-N-benzylphosphonamidic acid (PubChem CID 136592208) has the molecular formula C18H23N6O7P and a molecular weight of 466.39 g/mol. Its IUPAC name is [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-N-benzylphosphonamidic acid.
| Compound Name | [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
|---|---|
| PubChem CID | 136592208 |
| Molecular Formula | C18H23N6O7P |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | [(2R,4S,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-N-benzylphosphonamidic acid |
| SMILES | C[C@]1(O)C(O)[C@@H](COP(=O)(O)NCc2ccccc2)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C18H23N6O7P/c1-18(27)13(25)11(8-30-32(28,29)21-7-10-5-3-2-4-6-10)31-16(18)24-9-20-12-14(24)22-17(19)23-15(12)26/h2-6,9,11,13,16,25,27H,7-8H2,1H3,(H2,21,28,29)(H3,19,22,23,26)/t11-,13?,16-,18+/m1/s1 |
| InChIKey | JVLKABLEMWVLKK-INCTVEMMSA-N |
| XLogP | -0.38 |
| TPSA | 197.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|