C27H37N6O10PS — CID 136501321
[3-[2-[[(3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] acetate (PubChem CID 136501321) has the molecular formula C27H37N6O10PS and a molecular weight of 668.67 g/mol. Its IUPAC name is [3-[2-[[(3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] acetate.
| Compound Name | [3-[2-[[(3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 136501321 |
| Molecular Formula | C27H37N6O10PS |
| Molecular Weight | 668.67 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | [3-[2-[[(3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] acetate |
| SMILES | CC(=O)OCC(C)(C)C(=O)SCCOP(=O)(NCc1ccccc1)OCC1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C27H37N6O10PS/c1-16(34)40-14-26(2,3)24(37)45-11-10-41-44(39,30-12-17-8-6-5-7-9-17)42-13-18-20(35)27(4,38)23(43-18)33-15-29-19-21(33)31-25(28)32-22(19)36/h5-9,15,18,20,23,35,38H,10-14H2,1-4H3,(H,30,39)(H3,28,31,32,36)/t18?,20-,23-,27-,44?/m1/s1 |
| InChIKey | DNHYDXXRTPXLSB-KQRCGEOJSA-N |
| XLogP | 1.49 |
| TPSA | 230.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|