C20H31N6O9PS — CID 136628011
S-[2-[amino-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2-methyl-2-prop-1-en-2-yloxypropanethioate (PubChem CID 136628011) has the molecular formula C20H31N6O9PS and a molecular weight of 562.54 g/mol. Its IUPAC name is S-[2-[amino-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2-methyl-2-prop-1-en-2-yloxypropanethioate.
| Compound Name | S-[2-[amino-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2-methyl-2-prop-1-en-2-yloxypropanethioate |
|---|---|
| PubChem CID | 136628011 |
| Molecular Formula | C20H31N6O9PS |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.16 |
| IUPAC Name | S-[2-[amino-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy]phosphoryl]oxyethyl] 2-methyl-2-prop-1-en-2-yloxypropanethioate |
| SMILES | C=C(C)OC(C)(C)C(=O)SCCOP(N)(=O)OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(C)(O)C1O |
| InChI | InChI=1S/C20H31N6O9PS/c1-10(2)35-19(3,4)17(29)37-7-6-32-36(22,31)33-8-11-13(27)20(5,30)16(34-11)26-9-23-12-14(26)24-18(21)25-15(12)28/h9,11,13,16,27,30H,1,6-8H2,2-5H3,(H2,22,31)(H3,21,24,25,28) |
| InChIKey | KITJTCYZCKUCGG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 227.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|