C18H29N6O8PS — CID 136645310
ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate (PubChem CID 136645310) has the molecular formula C18H29N6O8PS and a molecular weight of 520.51 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 136645310 |
| Molecular Formula | C18H29N6O8PS |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | ethyl (2R)-2-[[[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-ethylsulfanylphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)N[P@](=O)(OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]c(N)nc32)[C@](C)(O)[C@@H]1O)SCC |
| InChI | InChI=1S/C18H29N6O8PS/c1-5-30-15(27)9(3)23-33(29,34-6-2)31-7-10-12(25)18(4,28)16(32-10)24-8-20-11-13(24)21-17(19)22-14(11)26/h8-10,12,16,25,28H,5-7H2,1-4H3,(H,23,29)(H3,19,21,22,26)/t9-,10-,12-,16-,18-,33+/m1/s1 |
| InChIKey | HPLVEDVYVZVMSF-NFQOPCGASA-N |
| XLogP | 0.13 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|