C29H41N6O10PS — CID 137042886
[3-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] butanoate (PubChem CID 137042886) has the molecular formula C29H41N6O10PS and a molecular weight of 696.72 g/mol. Its IUPAC name is [3-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] butanoate.
| Compound Name | [3-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] butanoate |
|---|---|
| PubChem CID | 137042886 |
| Molecular Formula | C29H41N6O10PS |
| Molecular Weight | 696.72 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | [3-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethylsulfanyl]-2,2-dimethyl-3-oxopropyl] butanoate |
| SMILES | CCCC(=O)OCC(C)(C)C(=O)SCCOP(=O)(NCc1ccccc1)OCC1OC(n2cnc3c(=O)[nH]c(N)nc32)C(C)(O)C1O |
| InChI | InChI=1S/C29H41N6O10PS/c1-5-9-20(36)42-16-28(2,3)26(39)47-13-12-43-46(41,32-14-18-10-7-6-8-11-18)44-15-19-22(37)29(4,40)25(45-19)35-17-31-21-23(35)33-27(30)34-24(21)38/h6-8,10-11,17,19,22,25,37,40H,5,9,12-16H2,1-4H3,(H,32,41)(H3,30,33,34,38) |
| InChIKey | QOKMRXVRQBBZHU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 230.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|