C25H35N6O8PS — CID 173466591
S-[2-[[(2R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 173466591) has the molecular formula C25H35N6O8PS and a molecular weight of 610.63 g/mol. Its IUPAC name is S-[2-[[(2R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 173466591 |
| Molecular Formula | C25H35N6O8PS |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | S-[2-[[(2R,4S,5S)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1O[C@H](n2cnc3c(N)ncnc32)[C@@](C)(O)C1O |
| InChI | InChI=1S/C25H35N6O8PS/c1-24(2,13-32)23(34)41-10-9-37-40(36,30-11-16-7-5-4-6-8-16)38-12-17-19(33)25(3,35)22(39-17)31-15-29-18-20(26)27-14-28-21(18)31/h4-8,14-15,17,19,22,32-33,35H,9-13H2,1-3H3,(H,30,36)(H2,26,27,28)/t17-,19?,22+,25+,40?/m1/s1 |
| InChIKey | GCCDPNYVUIYRSI-RLMKPHQZSA-N |
| XLogP | 1.63 |
| TPSA | 204.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|