C25H34N5O8PS — CID 143717413
S-[2-[(benzylamino)-[[(2S,4R,5R)-4-hydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 143717413) has the molecular formula C25H34N5O8PS and a molecular weight of 595.62 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[[(2S,4R,5R)-4-hydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(benzylamino)-[[(2S,4R,5R)-4-hydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 143717413 |
| Molecular Formula | C25H34N5O8PS |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | S-[2-[(benzylamino)-[[(2S,4R,5R)-4-hydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@@H]1C[C@@](C)(O)[C@H](n2cnc3c(=O)[nH]cnc32)O1 |
| InChI | InChI=1S/C25H34N5O8PS/c1-24(2,14-31)23(33)40-10-9-36-39(35,29-12-17-7-5-4-6-8-17)37-13-18-11-25(3,34)22(38-18)30-16-28-19-20(30)26-15-27-21(19)32/h4-8,15-16,18,22,31,34H,9-14H2,1-3H3,(H,29,35)(H,26,27,32)/t18-,22+,25+,39?/m0/s1 |
| InChIKey | ZDYAVNLAAGJDPP-FOYDALOASA-N |
| XLogP | 2.37 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|