C26H45N6O9PS — CID 136659385
S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-4-methyloxolan-2-yl]methoxy-[[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]amino]phosphoryl]oxyethyl] 2,2-dimethylpentanethioate (PubChem CID 136659385) has the molecular formula C26H45N6O9PS and a molecular weight of 648.72 g/mol. Its IUPAC name is S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-4-methyloxolan-2-yl]methoxy-[[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]amino]phosphoryl]oxyethyl] 2,2-dimethylpentanethioate.
| Compound Name | S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-4-methyloxolan-2-yl]methoxy-[[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]amino]phosphoryl]oxyethyl] 2,2-dimethylpentanethioate |
|---|---|
| PubChem CID | 136659385 |
| Molecular Formula | C26H45N6O9PS |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.27 |
| IUPAC Name | S-[2-[[5-(2-amino-6-oxo-1H-purin-9-yl)-4-hydroxy-4-methyloxolan-2-yl]methoxy-[[2-hydroxy-2-[(2-methylpropan-2-yl)oxy]ethyl]amino]phosphoryl]oxyethyl] 2,2-dimethylpentanethioate |
| SMILES | CCCC(C)(C)C(=O)SCCOP(=O)(NCC(O)OC(C)(C)C)OCC1CC(C)(O)C(n2cnc3c(=O)[nH]c(N)nc32)O1 |
| InChI | InChI=1S/C26H45N6O9PS/c1-8-9-25(5,6)22(35)43-11-10-38-42(37,29-13-17(33)41-24(2,3)4)39-14-16-12-26(7,36)21(40-16)32-15-28-18-19(32)30-23(27)31-20(18)34/h15-17,21,33,36H,8-14H2,1-7H3,(H,29,37)(H3,27,30,31,34) |
| InChIKey | LLVIBXZXSQWSTN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 213.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|