C26H36N5O8PS — CID 137067945
S-[2-[(benzylamino)-[2-[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]ethyl]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 137067945) has the molecular formula C26H36N5O8PS and a molecular weight of 609.64 g/mol. Its IUPAC name is S-[2-[(benzylamino)-[2-[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]ethyl]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[(benzylamino)-[2-[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]ethyl]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 137067945 |
| Molecular Formula | C26H36N5O8PS |
| Molecular Weight | 609.64 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | S-[2-[(benzylamino)-[2-[(2R,3R,4R,5R)-3,4-dihydroxy-4-methyl-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]ethyl]phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(CC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@](C)(O)[C@@H]1O)NCc1ccccc1 |
| InChI | InChI=1S/C26H36N5O8PS/c1-25(2,14-32)24(35)41-12-10-38-40(37,30-13-17-7-5-4-6-8-17)11-9-18-20(33)26(3,36)23(39-18)31-16-29-19-21(31)27-15-28-22(19)34/h4-8,15-16,18,20,23,32-33,36H,9-14H2,1-3H3,(H,30,37)(H,27,28,34)/t18-,20-,23-,26-,40?/m1/s1 |
| InChIKey | RLGZOGMJRGHERK-IFPWSLDNSA-N |
| XLogP | 1.80 |
| TPSA | 188.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|