C24H35N4O9PS — CID 88884526
S-[2-[[(3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 88884526) has the molecular formula C24H35N4O9PS and a molecular weight of 586.60 g/mol. Its IUPAC name is S-[2-[[(3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 88884526 |
| Molecular Formula | C24H35N4O9PS |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | S-[2-[[(3R,4R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OCC1OC(n2ccc(N)nc2=O)[C@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C24H35N4O9PS/c1-23(2,15-29)21(31)39-12-11-35-38(34,26-13-16-7-5-4-6-8-16)36-14-17-19(30)24(3,33)20(37-17)28-10-9-18(25)27-22(28)32/h4-10,17,19-20,29-30,33H,11-15H2,1-3H3,(H,26,34)(H2,25,27,32)/t17?,19-,20?,24-,38?/m1/s1 |
| InChIKey | QMZXWBWGMVJQAT-NOSSZVRDSA-N |
| XLogP | 1.04 |
| TPSA | 195.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|