C24H34FN4O8PS — CID 88943417
S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 88943417) has the molecular formula C24H34FN4O8PS and a molecular weight of 588.60 g/mol. Its IUPAC name is S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 88943417 |
| Molecular Formula | C24H34FN4O8PS |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | S-[2-[[(2R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1O[C@@H](n2ccc(N)nc2=O)C(C)(F)C1O |
| InChI | InChI=1S/C24H34FN4O8PS/c1-23(2,15-30)21(32)39-12-11-35-38(34,27-13-16-7-5-4-6-8-16)36-14-17-19(31)24(3,25)20(37-17)29-10-9-18(26)28-22(29)33/h4-10,17,19-20,30-31H,11-15H2,1-3H3,(H,27,34)(H2,26,28,33)/t17-,19?,20-,24?,38?/m1/s1 |
| InChIKey | UWVDUNBBKMTSGQ-AKPWLHPDSA-N |
| XLogP | 2.02 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|