C29H41N4O10PS — CID 89148883
[(3R,5R)-2-acetyloxy-3-(4-amino-2-oxopyrimidin-1-yl)-5-[[(benzylamino)-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]oxymethyl]-2-methylcyclopentyl] acetate (PubChem CID 89148883) has the molecular formula C29H41N4O10PS and a molecular weight of 668.71 g/mol. Its IUPAC name is [(3R,5R)-2-acetyloxy-3-(4-amino-2-oxopyrimidin-1-yl)-5-[[(benzylamino)-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]oxymethyl]-2-methylcyclopentyl] acetate.
| Compound Name | [(3R,5R)-2-acetyloxy-3-(4-amino-2-oxopyrimidin-1-yl)-5-[[(benzylamino)-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]oxymethyl]-2-methylcyclopentyl] acetate |
|---|---|
| PubChem CID | 89148883 |
| Molecular Formula | C29H41N4O10PS |
| Molecular Weight | 668.71 g/mol |
| Exact Mass | 668.23 |
| IUPAC Name | [(3R,5R)-2-acetyloxy-3-(4-amino-2-oxopyrimidin-1-yl)-5-[[(benzylamino)-[2-(3-hydroxy-2,2-dimethylpropanoyl)sulfanylethoxy]phosphoryl]oxymethyl]-2-methylcyclopentyl] acetate |
| SMILES | CC(=O)OC1[C@@H](COP(=O)(NCc2ccccc2)OCCSC(=O)C(C)(C)CO)C[C@@H](n2ccc(N)nc2=O)C1(C)OC(C)=O |
| InChI | InChI=1S/C29H41N4O10PS/c1-19(35)42-25-22(15-23(29(25,5)43-20(2)36)33-12-11-24(30)32-27(33)38)17-41-44(39,31-16-21-9-7-6-8-10-21)40-13-14-45-26(37)28(3,4)18-34/h6-12,22-23,25,34H,13-18H2,1-5H3,(H,31,39)(H2,30,32,38)/t22-,23-,25?,29?,44?/m1/s1 |
| InChIKey | VMWZDUMHKQJHQJ-JGMRIBGVSA-N |
| XLogP | 2.85 |
| TPSA | 198.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|