C27H37N4O8PS — CID 90397399
S-[2-[[(2R,3R,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 90397399) has the molecular formula C27H37N4O8PS and a molecular weight of 608.65 g/mol. Its IUPAC name is S-[2-[[(2R,3R,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[(2R,3R,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 90397399 |
| Molecular Formula | C27H37N4O8PS |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | S-[2-[[(2R,3R,5S)-5-(4-aminopyrrolo[2,3-b]pyridin-1-yl)-3,4-dihydroxy-5-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OC[C@H]1O[C@](C)(n2ccc3c(N)ccnc32)C(O)[C@H]1O |
| InChI | InChI=1S/C27H37N4O8PS/c1-26(2,17-32)25(35)41-14-13-37-40(36,30-15-18-7-5-4-6-8-18)38-16-21-22(33)23(34)27(3,39-21)31-12-10-19-20(28)9-11-29-24(19)31/h4-12,21-23,32-34H,13-17H2,1-3H3,(H2,28,29)(H,30,36)/t21-,22+,23?,27+,40?/m1/s1 |
| InChIKey | LZMLXBTURPOSND-DIRSYUBPSA-N |
| XLogP | 2.62 |
| TPSA | 178.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|