C23H32ClN4O8PS — CID 123535428
S-[2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate (PubChem CID 123535428) has the molecular formula C23H32ClN4O8PS and a molecular weight of 591.02 g/mol. Its IUPAC name is S-[2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123535428 |
| Molecular Formula | C23H32ClN4O8PS |
| Molecular Weight | 591.02 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | S-[2-[[5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-3-hydroxyoxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 3-hydroxy-2,2-dimethylpropanethioate |
| SMILES | CC(C)(CO)C(=O)SCCOP(=O)(NCc1ccccc1)OCC1OC(n2ccc(N)nc2=O)C(Cl)C1O |
| InChI | InChI=1S/C23H32ClN4O8PS/c1-23(2,14-29)21(31)38-11-10-34-37(33,26-12-15-6-4-3-5-7-15)35-13-16-19(30)18(24)20(36-16)28-9-8-17(25)27-22(28)32/h3-9,16,18-20,29-30H,10-14H2,1-2H3,(H,26,33)(H2,25,27,32) |
| InChIKey | HCQRQOXNIWTUEZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.02 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|