C30H44N7O8PS — CID 144606332
S-[2-[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate (PubChem CID 144606332) has the molecular formula C30H44N7O8PS and a molecular weight of 693.76 g/mol. Its IUPAC name is S-[2-[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate.
| Compound Name | S-[2-[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
|---|---|
| PubChem CID | 144606332 |
| Molecular Formula | C30H44N7O8PS |
| Molecular Weight | 693.76 g/mol |
| Exact Mass | 693.27 |
| IUPAC Name | S-[2-[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-methyloxolan-2-yl]methoxy-(benzylamino)phosphoryl]oxyethyl] 4-(methoxycarbonylamino)-2,2-dimethylbutanethioate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](COP(=O)(NCc2ccccc2)OCCSC(=O)C(C)(C)CCNC(=O)OC)C[C@@H]1C |
| InChI | InChI=1S/C30H44N7O8PS/c1-6-42-25-23-24(35-28(31)36-25)37(19-33-23)26-20(2)16-22(45-26)18-44-46(40,34-17-21-10-8-7-9-11-21)43-14-15-47-27(38)30(3,4)12-13-32-29(39)41-5/h7-11,19-20,22,26H,6,12-18H2,1-5H3,(H,32,39)(H,34,40)(H2,31,35,36)/t20-,22-,26+,46?/m0/s1 |
| InChIKey | WTNXGRWCOORPGJ-XYNDZVAKSA-N |
| XLogP | 4.69 |
| TPSA | 191.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.76 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|