C25H40ClN6O7PS2 — CID 144854040
propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chlorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 144854040) has the molecular formula C25H40ClN6O7PS2 and a molecular weight of 667.19 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chlorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chlorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 144854040 |
| Molecular Formula | C25H40ClN6O7PS2 |
| Molecular Weight | 667.19 g/mol |
| Exact Mass | 666.18 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(2-amino-6-ethoxypurin-9-yl)-4-chlorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CCOc1nc(N)nc2c1ncn2[C@@H]1O[C@H](CO[P@@](=S)(N[C@@H](C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C)C[C@@H]1Cl |
| InChI | InChI=1S/C25H40ClN6O7PS2/c1-8-35-20-18-19(29-24(27)30-20)32(13-28-18)21-17(26)11-16(39-21)12-37-40(41,31-15(4)22(33)38-14(2)3)36-9-10-42-23(34)25(5,6)7/h13-17,21H,8-12H2,1-7H3,(H,31,41)(H2,27,29,30)/t15-,16-,17-,21+,40+/m0/s1 |
| InChIKey | WSVREYJNQPUZOB-VONVYYNCSA-N |
| XLogP | 4.20 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.19 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|