C23H36Cl2N7O6PS2 — CID 144853942
propan-2-yl (2S)-2-[[[(2S,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 144853942) has the molecular formula C23H36Cl2N7O6PS2 and a molecular weight of 672.60 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 144853942 |
| Molecular Formula | C23H36Cl2N7O6PS2 |
| Molecular Weight | 672.60 g/mol |
| Exact Mass | 671.13 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,5R)-4,4-dichloro-5-(2,6-diaminopurin-9-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=S)(OCCSC(=O)C(C)(C)C)OC[C@@H]1CC(Cl)(Cl)[C@H](n2cnc3c(N)nc(N)nc32)O1 |
| InChI | InChI=1S/C23H36Cl2N7O6PS2/c1-12(2)37-18(33)13(3)31-39(40,35-7-8-41-20(34)22(4,5)6)36-10-14-9-23(24,25)19(38-14)32-11-28-15-16(26)29-21(27)30-17(15)32/h11-14,19H,7-10H2,1-6H3,(H,31,40)(H4,26,27,29,30)/t13-,14-,19+,39-/m0/s1 |
| InChIKey | DZFLUYADBLYMND-ZAZWNOGCSA-N |
| XLogP | 3.95 |
| TPSA | 178.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.60 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|