C23H35ClFN6O6PS2 — CID 144853910
propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate (PubChem CID 144853910) has the molecular formula C23H35ClFN6O6PS2 and a molecular weight of 641.13 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
|---|---|
| PubChem CID | 144853910 |
| Molecular Formula | C23H35ClFN6O6PS2 |
| Molecular Weight | 641.13 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphinothioyl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@@](=S)(OCCSC(=O)C(C)(C)C)OC[C@@H]1C[C@](F)(Cl)[C@H](n2cnc3c(N)ncnc32)O1 |
| InChI | InChI=1S/C23H35ClFN6O6PS2/c1-13(2)36-19(32)14(3)30-38(39,34-7-8-40-21(33)22(4,5)6)35-10-15-9-23(24,25)20(37-15)31-12-29-16-17(26)27-11-28-18(16)31/h11-15,20H,7-10H2,1-6H3,(H,30,39)(H2,26,27,28)/t14-,15-,20+,23+,38+/m0/s1 |
| InChIKey | BPTOQXWUVCXUNV-LSTPBVEVSA-N |
| XLogP | 4.09 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|