C22H35ClFN4O8PS — CID 144854031
propan-2-yl 2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 144854031) has the molecular formula C22H35ClFN4O8PS and a molecular weight of 601.03 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 144854031 |
| Molecular Formula | C22H35ClFN4O8PS |
| Molecular Weight | 601.03 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | propan-2-yl 2-[[[(2S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-chloro-4-fluorooxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OCCSC(=O)C(C)(C)C)OC[C@@H]1C[C@](F)(Cl)[C@H](n2ccc(N)nc2=O)O1 |
| InChI | InChI=1S/C22H35ClFN4O8PS/c1-13(2)35-17(29)14(3)27-37(32,33-9-10-38-19(30)21(4,5)6)34-12-15-11-22(23,24)18(36-15)28-8-7-16(25)26-20(28)31/h7-8,13-15,18H,9-12H2,1-6H3,(H,27,32)(H2,25,26,31)/t14?,15-,18+,22+,37?/m0/s1 |
| InChIKey | LOKFROXTJVUTGB-MDKJUENVSA-N |
| XLogP | 3.39 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.03 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|