C22H36ClFN3O8PS — CID 123748150
S-[2-[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-(1-propan-2-yloxypropan-2-ylamino)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate (PubChem CID 123748150) has the molecular formula C22H36ClFN3O8PS and a molecular weight of 588.04 g/mol. Its IUPAC name is S-[2-[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-(1-propan-2-yloxypropan-2-ylamino)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[2-[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-(1-propan-2-yloxypropan-2-ylamino)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123748150 |
| Molecular Formula | C22H36ClFN3O8PS |
| Molecular Weight | 588.04 g/mol |
| Exact Mass | 587.16 |
| IUPAC Name | S-[2-[[4-chloro-5-(2,4-dioxopyrimidin-1-yl)-4-fluorooxolan-2-yl]methoxy-(1-propan-2-yloxypropan-2-ylamino)phosphoryl]oxyethyl] 2,2-dimethylpropanethioate |
| SMILES | CC(COC(C)C)NP(=O)(OCCSC(=O)C(C)(C)C)OCC1CC(F)(Cl)C(n2ccc(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C22H36ClFN3O8PS/c1-14(2)32-12-15(3)26-36(31,33-9-10-37-19(29)21(4,5)6)34-13-16-11-22(23,24)18(35-16)27-8-7-17(28)25-20(27)30/h7-8,14-16,18H,9-13H2,1-6H3,(H,26,31)(H,25,28,30) |
| InChIKey | IQMNUWLIHHCMDU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.04 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|