C23H37FN3O10PS — CID 118465969
propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate (PubChem CID 118465969) has the molecular formula C23H37FN3O10PS and a molecular weight of 597.60 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118465969 |
| Molecular Formula | C23H37FN3O10PS |
| Molecular Weight | 597.60 g/mol |
| Exact Mass | 597.19 |
| IUPAC Name | propan-2-yl (2S)-2-[[2-(2,2-dimethylpropanoylsulfanyl)ethoxy-[[(2S,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-(fluoromethyl)-4-hydroxyoxolan-2-yl]methoxy]phosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)N[P@](=O)(OCCSC(=O)C(C)(C)C)OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H](O)[C@@H]1CF |
| InChI | InChI=1S/C23H37FN3O10PS/c1-13(2)36-20(30)14(3)26-38(33,34-9-10-39-21(31)23(4,5)6)35-12-16-15(11-24)18(29)19(37-16)27-8-7-17(28)25-22(27)32/h7-8,13-16,18-19,29H,9-12H2,1-6H3,(H,26,33)(H,25,28,32)/t14-,15+,16+,18+,19+,38-/m0/s1 |
| InChIKey | GFMSYJJNQBOYIE-ZXPXGDEZSA-N |
| XLogP | 1.76 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|