C23H36ClFN3O10PS — CID 123458410
propan-2-yl 2-[[[4-chloro-4-fluoro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate (PubChem CID 123458410) has the molecular formula C23H36ClFN3O10PS and a molecular weight of 632.04 g/mol. Its IUPAC name is propan-2-yl 2-[[[4-chloro-4-fluoro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[4-chloro-4-fluoro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123458410 |
| Molecular Formula | C23H36ClFN3O10PS |
| Molecular Weight | 632.04 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | propan-2-yl 2-[[[4-chloro-4-fluoro-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-[2-(2,2-dimethylpropanoylsulfanyl)ethoxy]phosphoryl]amino]propanoate |
| SMILES | Cc1cn(C2OC(COP(=O)(NC(C)C(=O)OC(C)C)OCCSC(=O)C(C)(C)C)C(O)C2(F)Cl)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H36ClFN3O10PS/c1-12(2)37-18(31)14(4)27-39(34,35-8-9-40-20(32)22(5,6)7)36-11-15-16(29)23(24,25)19(38-15)28-10-13(3)17(30)26-21(28)33/h10,12,14-16,19,29H,8-9,11H2,1-7H3,(H,27,34)(H,26,30,33) |
| InChIKey | DIGGASOYQNOZJD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 175.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.04 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|