C21H25ClF2N3O9P — CID 118125884
propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118125884) has the molecular formula C21H25ClF2N3O9P and a molecular weight of 567.87 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118125884 |
| Molecular Formula | C21H25ClF2N3O9P |
| Molecular Weight | 567.87 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | propan-2-yl (2R)-2-[[[(2R,3R,4S,5R)-4-chloro-4-fluoro-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](C)N[P@@](=O)(OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@](F)(Cl)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C21H25ClF2N3O9P/c1-11(2)34-18(30)12(3)26-37(32,36-13-7-5-4-6-8-13)33-10-15-16(28)21(22,24)19(35-15)27-9-14(23)17(29)25-20(27)31/h4-9,11-12,15-16,19,28H,10H2,1-3H3,(H,26,32)(H,25,29,31)/t12-,15-,16-,19-,21-,37-/m1/s1 |
| InChIKey | SVIGSFRTFQKGDB-FTQOGKFWSA-N |
| XLogP | 1.97 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.87 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|