C22H28F2N3O10P — CID 130425753
propan-2-yl (2S)-2-[[[(2R,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 130425753) has the molecular formula C22H28F2N3O10P and a molecular weight of 563.45 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[[(2R,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[[(2R,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 130425753 |
| Molecular Formula | C22H28F2N3O10P |
| Molecular Weight | 563.45 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | propan-2-yl (2S)-2-[[[(2R,4R,5R)-5-(5-fluoro-2,4-dioxopyrimidin-1-yl)-4-(fluoromethyl)-3,4-dihydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cc(F)c(=O)[nH]c2=O)[C@@](O)(CF)C1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H28F2N3O10P/c1-12(2)35-19(30)13(3)26-38(33,37-14-7-5-4-6-8-14)34-10-16-17(28)22(32,11-23)20(36-16)27-9-15(24)18(29)25-21(27)31/h4-9,12-13,16-17,20,28,32H,10-11H2,1-3H3,(H,26,33)(H,25,29,31)/t13-,16+,17?,20+,22+,38?/m0/s1 |
| InChIKey | QOLAEEYAKDBBOK-BUKWDTRDSA-N |
| XLogP | 0.77 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|